C27H47Cl3O7Si — CID 59627900
(3S,6R,7S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8,12-pentamethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)tridec-12-enoic acid (PubChem CID 59627900) has the molecular formula C27H47Cl3O7Si and a molecular weight of 618.11 g/mol. Its IUPAC name is (3S,6R,7S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8,12-pentamethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)tridec-12-enoic acid.
| Compound Name | (3S,6R,7S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8,12-pentamethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)tridec-12-enoic acid |
|---|---|
| PubChem CID | 59627900 |
| Molecular Formula | C27H47Cl3O7Si |
| Molecular Weight | 618.11 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | (3S,6R,7S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8,12-pentamethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)tridec-12-enoic acid |
| SMILES | C=C(C)CCC[C@H](C)[C@H](OC(=O)OCC(Cl)(Cl)Cl)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H47Cl3O7Si/c1-17(2)13-12-14-18(3)22(36-24(34)35-16-27(28,29)30)19(4)23(33)26(8,9)20(15-21(31)32)37-38(10,11)25(5,6)7/h18-20,22H,1,12-16H2,2-11H3,(H,31,32)/t18-,19+,20-,22-/m0/s1 |
| InChIKey | AVZGEZXHTHIRJB-IIZPIQPGSA-N |
| XLogP | 8.36 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.11 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|