C36H74O7Si3 — CID 11377513
(Z,3S,6R,7S,8S,15S,16R)-3,16-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-4,4,6,8-tetramethyl-5-oxo-15-trimethylsilyloxyheptadec-12-enoic acid (PubChem CID 11377513) has the molecular formula C36H74O7Si3 and a molecular weight of 703.24 g/mol. Its IUPAC name is (Z,3S,6R,7S,8S,15S,16R)-3,16-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-4,4,6,8-tetramethyl-5-oxo-15-trimethylsilyloxyheptadec-12-enoic acid.
| Compound Name | (Z,3S,6R,7S,8S,15S,16R)-3,16-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-4,4,6,8-tetramethyl-5-oxo-15-trimethylsilyloxyheptadec-12-enoic acid |
|---|---|
| PubChem CID | 11377513 |
| Molecular Formula | C36H74O7Si3 |
| Molecular Weight | 703.24 g/mol |
| Exact Mass | 702.47 |
| IUPAC Name | (Z,3S,6R,7S,8S,15S,16R)-3,16-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-4,4,6,8-tetramethyl-5-oxo-15-trimethylsilyloxyheptadec-12-enoic acid |
| SMILES | C[C@@H](CCC/C=C\C[C@H](O[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H74O7Si3/c1-26(23-21-19-20-22-24-29(42-44(12,13)14)28(3)41-45(15,16)34(4,5)6)32(39)27(2)33(40)36(10,11)30(25-31(37)38)43-46(17,18)35(7,8)9/h20,22,26-30,32,39H,19,21,23-25H2,1-18H3,(H,37,38)/b22-20-/t26-,27+,28+,29-,30-,32-/m0/s1 |
| InChIKey | GJOIGANGSBQCKS-ADUQDQLFSA-N |
| XLogP | 9.83 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.24 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|