C17H30O7 — CID 11824170
(5S,6S,7R,10S)-6,10-dihydroxy-12-methoxy-5,7,9,9-tetramethyl-8,12-dioxododecanoic acid (PubChem CID 11824170) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is (5S,6S,7R,10S)-6,10-dihydroxy-12-methoxy-5,7,9,9-tetramethyl-8,12-dioxododecanoic acid.
| Compound Name | (5S,6S,7R,10S)-6,10-dihydroxy-12-methoxy-5,7,9,9-tetramethyl-8,12-dioxododecanoic acid |
|---|---|
| PubChem CID | 11824170 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (5S,6S,7R,10S)-6,10-dihydroxy-12-methoxy-5,7,9,9-tetramethyl-8,12-dioxododecanoic acid |
| SMILES | COC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCCC(=O)O |
| InChI | InChI=1S/C17H30O7/c1-10(7-6-8-13(19)20)15(22)11(2)16(23)17(3,4)12(18)9-14(21)24-5/h10-12,15,18,22H,6-9H2,1-5H3,(H,19,20)/t10-,11+,12-,15-/m0/s1 |
| InChIKey | FHSGRFVTPQZCNE-OXIQGZBJSA-N |
| XLogP | 1.39 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |