C29H51N3O6 — CID 90793484
11-[3-[(E)-2-azido-3-methylpent-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid;(Z)-pent-2-ene (PubChem CID 90793484) has the molecular formula C29H51N3O6 and a molecular weight of 537.74 g/mol. Its IUPAC name is 11-[3-[(E)-2-azido-3-methylpent-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid;(Z)-pent-2-ene.
| Compound Name | 11-[3-[(E)-2-azido-3-methylpent-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 90793484 |
| Molecular Formula | C29H51N3O6 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | 11-[3-[(E)-2-azido-3-methylpent-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid;(Z)-pent-2-ene |
| SMILES | C/C=C(\C)C(CC1OC1(C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O)N=[N+]=[N-].C/C=C\CC |
| InChI | InChI=1S/C24H41N3O6.C5H10/c1-8-14(2)17(26-27-25)12-19-24(7,33-19)11-9-10-15(3)21(31)16(4)22(32)23(5,6)18(28)13-20(29)30;1-3-5-4-2/h8,15-19,21,28,31H,9-13H2,1-7H3,(H,29,30);3,5H,4H2,1-2H3/b14-8+;5-3- |
| InChIKey | XNLMCJJWCFDFHT-OAXWCLICSA-N |
| XLogP | 6.39 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|