C28H44N4O5S — CID 158381001
(2S,5R,6S,7S)-10-[(2R,3S)-3-[(E,2S)-2-azido-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-2-hydroxy-3,3,5,6,7-pentamethyldecan-4-one;carbon dioxide (PubChem CID 158381001) has the molecular formula C28H44N4O5S and a molecular weight of 548.75 g/mol. Its IUPAC name is (2S,5R,6S,7S)-10-[(2R,3S)-3-[(E,2S)-2-azido-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-2-hydroxy-3,3,5,6,7-pentamethyldecan-4-one;carbon dioxide.
| Compound Name | (2S,5R,6S,7S)-10-[(2R,3S)-3-[(E,2S)-2-azido-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-2-hydroxy-3,3,5,6,7-pentamethyldecan-4-one;carbon dioxide |
|---|---|
| PubChem CID | 158381001 |
| Molecular Formula | C28H44N4O5S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | (2S,5R,6S,7S)-10-[(2R,3S)-3-[(E,2S)-2-azido-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-2-hydroxy-3,3,5,6,7-pentamethyldecan-4-one;carbon dioxide |
| SMILES | C/C(=C\c1csc(C)n1)[C@H](C[C@@H]1O[C@]1(C)CCC[C@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)[C@H](C)O)N=[N+]=[N-].O=C=O |
| InChI | InChI=1S/C27H44N4O3S.CO2/c1-16(18(3)19(4)25(33)26(7,8)20(5)32)11-10-12-27(9)24(34-27)14-23(30-31-28)17(2)13-22-15-35-21(6)29-22;2-1-3/h13,15-16,18-20,23-24,32H,10-12,14H2,1-9H3;/b17-13+;/t16-,18-,19+,20-,23-,24-,27+;/m0./s1 |
| InChIKey | GVUBZGOXMZVUDJ-GNBVKLFGSA-N |
| XLogP | 6.55 |
| TPSA | 145.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|