3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid

C14H24O5 — CID 163057760

IUPAC3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid
SMILESC=CC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O
InChIInChI=1S/C14H24O5/c1-6-8(2)12(18)9(3)13(19)14(4,5)10(15)7-11(16)17/h6,8-10,12,15,18H,1,7H2,2-5H3,(H,16,17)
InChIKeyWBUJALCHSNKAMZ-UHFFFAOYSA-N
MW272.34 g/mol
LogP1.24
Rot. Bonds8

About 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid

3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid (PubChem CID 163057760) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid.

Molecular Properties

Compound Name3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid
PubChem CID163057760
Molecular FormulaC14H24O5
Molecular Weight272.34 g/mol
Exact Mass272.16
IUPAC Name3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid
SMILESC=CC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O
InChIInChI=1S/C14H24O5/c1-6-8(2)12(18)9(3)13(19)14(4,5)10(15)7-11(16)17/h6,8-10,12,15,18H,1,7H2,2-5H3,(H,16,17)
InChIKeyWBUJALCHSNKAMZ-UHFFFAOYSA-N
XLogP1.24
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.34
LogP ≤ 51.24
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid?
The IUPAC name of 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid (CID 163057760) is 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid.
What is the SMILES notation for 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid?
The canonical SMILES for 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid is C=CC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O.
What is the InChIKey of 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid?
The InChIKey is WBUJALCHSNKAMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O5/c1-6-8(2)12(18)9(3)13(19)14(4,5)10(15)7-11(16)17/h6,8-10,12,15,18H,1,7H2,2-5H3,(H,16,17).
What are the key properties of 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid?
3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid has a molecular weight of 272.34 g/mol, XLogP of 1.24, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid is sourced from PubChem (CID 163057760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).