C14H24O5 — CID 163057760
3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid (PubChem CID 163057760) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid.
| Compound Name | 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid |
|---|---|
| PubChem CID | 163057760 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid |
| SMILES | C=CC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O |
| InChI | InChI=1S/C14H24O5/c1-6-8(2)12(18)9(3)13(19)14(4,5)10(15)7-11(16)17/h6,8-10,12,15,18H,1,7H2,2-5H3,(H,16,17) |
| InChIKey | WBUJALCHSNKAMZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|