C11H20O3 — CID 88980996
(3R,5R,6S)-3,6-dihydroxy-3,5,7-trimethyloct-1-en-4-one (PubChem CID 88980996) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3R,5R,6S)-3,6-dihydroxy-3,5,7-trimethyloct-1-en-4-one.
| Compound Name | (3R,5R,6S)-3,6-dihydroxy-3,5,7-trimethyloct-1-en-4-one |
|---|---|
| PubChem CID | 88980996 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (3R,5R,6S)-3,6-dihydroxy-3,5,7-trimethyloct-1-en-4-one |
| SMILES | C=C[C@@](C)(O)C(=O)[C@H](C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C11H20O3/c1-6-11(5,14)10(13)8(4)9(12)7(2)3/h6-9,12,14H,1H2,2-5H3/t8-,9+,11-/m1/s1 |
| InChIKey | GOJUROKSXMUKLM-WCABBAIRSA-N |
| XLogP | 1.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|