C10H16O6 — CID 158597437
2-hydroxy-2-methylbut-3-enoic acid;methyl 2-hydroxybut-3-enoate (PubChem CID 158597437) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-hydroxy-2-methylbut-3-enoic acid;methyl 2-hydroxybut-3-enoate.
| Compound Name | 2-hydroxy-2-methylbut-3-enoic acid;methyl 2-hydroxybut-3-enoate |
|---|---|
| PubChem CID | 158597437 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-hydroxy-2-methylbut-3-enoic acid;methyl 2-hydroxybut-3-enoate |
| SMILES | C=CC(C)(O)C(=O)O.C=CC(O)C(=O)OC |
| InChI | InChI=1S/2C5H8O3/c1-3-5(2,8)4(6)7;1-3-4(6)5(7)8-2/h3,8H,1H2,2H3,(H,6,7);3-4,6H,1H2,2H3 |
| InChIKey | HVFCNOLPSOESPL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|