C9H11F3O3 — CID 162033601
(2S,3R)-3-methyl-2-(3,3,3-trifluoro-2-oxopropyl)pent-4-enoic acid (PubChem CID 162033601) has the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2-(3,3,3-trifluoro-2-oxopropyl)pent-4-enoic acid.
| Compound Name | (2S,3R)-3-methyl-2-(3,3,3-trifluoro-2-oxopropyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 162033601 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (2S,3R)-3-methyl-2-(3,3,3-trifluoro-2-oxopropyl)pent-4-enoic acid |
| SMILES | C=C[C@@H](C)[C@H](CC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H11F3O3/c1-3-5(2)6(8(14)15)4-7(13)9(10,11)12/h3,5-6H,1,4H2,2H3,(H,14,15)/t5-,6+/m1/s1 |
| InChIKey | GWXXTZMMZHOJOU-RITPCOANSA-N |
| XLogP | 2.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|