C11H18F3NO4 — CID 121457049
(2S)-2-(hex-5-en-2-ylamino)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 121457049) has the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. Its IUPAC name is (2S)-2-(hex-5-en-2-ylamino)propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-(hex-5-en-2-ylamino)propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 121457049 |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2S)-2-(hex-5-en-2-ylamino)propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C=CCCC(C)N[C@@H](C)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H17NO2.C2HF3O2/c1-4-5-6-7(2)10-8(3)9(11)12;3-2(4,5)1(6)7/h4,7-8,10H,1,5-6H2,2-3H3,(H,11,12);(H,6,7)/t7?,8-;/m0./s1 |
| InChIKey | HIUDOHOGKJMYKD-MTICXXPYSA-N |
| XLogP | 2.04 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|