C27H42N4O7S — CID 57290106
(6R,7S,8S)-11-[(2R,3S)-3-[(2S)-2-azido-4-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-3-methylbutyl]-2-methyloxiran-2-yl]-7-hydroxy-4,4,6,8-tetramethyl-3,5-dioxoundecanoic acid (PubChem CID 57290106) has the molecular formula C27H42N4O7S and a molecular weight of 566.72 g/mol. Its IUPAC name is (6R,7S,8S)-11-[(2R,3S)-3-[(2S)-2-azido-4-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-3-methylbutyl]-2-methyloxiran-2-yl]-7-hydroxy-4,4,6,8-tetramethyl-3,5-dioxoundecanoic acid.
| Compound Name | (6R,7S,8S)-11-[(2R,3S)-3-[(2S)-2-azido-4-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-3-methylbutyl]-2-methyloxiran-2-yl]-7-hydroxy-4,4,6,8-tetramethyl-3,5-dioxoundecanoic acid |
|---|---|
| PubChem CID | 57290106 |
| Molecular Formula | C27H42N4O7S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | (6R,7S,8S)-11-[(2R,3S)-3-[(2S)-2-azido-4-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-3-methylbutyl]-2-methyloxiran-2-yl]-7-hydroxy-4,4,6,8-tetramethyl-3,5-dioxoundecanoic acid |
| SMILES | CC(Cc1csc(CO)n1)[C@H](C[C@@H]1O[C@]1(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)C(=O)CC(=O)O)N=[N+]=[N-] |
| InChI | InChI=1S/C27H42N4O7S/c1-15(24(36)17(3)25(37)26(4,5)20(33)12-23(34)35)8-7-9-27(6)21(38-27)11-19(30-31-28)16(2)10-18-14-39-22(13-32)29-18/h14-17,19,21,24,32,36H,7-13H2,1-6H3,(H,34,35)/t15-,16?,17+,19-,21-,24-,27+/m0/s1 |
| InChIKey | FBLDLARKZYECGT-HQDBWKMFSA-N |
| XLogP | 4.48 |
| TPSA | 186.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|