C33H43Cl3F3NO6S — CID 20817531
[(1E,5Z)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)-6-(trifluoromethyl)octa-1,5,7-trien-3-yl] 3,4,4,6,8-pentamethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate (PubChem CID 20817531) has the molecular formula C33H43Cl3F3NO6S and a molecular weight of 745.13 g/mol. Its IUPAC name is [(1E,5Z)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)-6-(trifluoromethyl)octa-1,5,7-trien-3-yl] 3,4,4,6,8-pentamethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate.
| Compound Name | [(1E,5Z)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)-6-(trifluoromethyl)octa-1,5,7-trien-3-yl] 3,4,4,6,8-pentamethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate |
|---|---|
| PubChem CID | 20817531 |
| Molecular Formula | C33H43Cl3F3NO6S |
| Molecular Weight | 745.13 g/mol |
| Exact Mass | 743.18 |
| IUPAC Name | [(1E,5Z)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)-6-(trifluoromethyl)octa-1,5,7-trien-3-yl] 3,4,4,6,8-pentamethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate |
| SMILES | C=CCC(C)C(OC(=O)OCC(Cl)(Cl)Cl)C(C)C(=O)C(C)(C)C(C)CC(=O)OC(C/C=C(/C=C)C(F)(F)F)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C33H43Cl3F3NO6S/c1-10-12-19(3)28(46-30(43)44-18-32(34,35)36)22(6)29(42)31(8,9)21(5)16-27(41)45-26(14-13-24(11-2)33(37,38)39)20(4)15-25-17-47-23(7)40-25/h10-11,13,15,17,19,21-22,26,28H,1-2,12,14,16,18H2,3-9H3/b20-15+,24-13- |
| InChIKey | IERIIZGMGJDNPG-HFZUNZQBSA-N |
| XLogP | 10.19 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.13 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|