C16H21NO2S — CID 11266290
[(1E,3S,5Z)-2,6-dimethyl-1-(2-methyl-1,3-thiazol-4-yl)octa-1,5,7-trien-3-yl] acetate (PubChem CID 11266290) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is [(1E,3S,5Z)-2,6-dimethyl-1-(2-methyl-1,3-thiazol-4-yl)octa-1,5,7-trien-3-yl] acetate.
| Compound Name | [(1E,3S,5Z)-2,6-dimethyl-1-(2-methyl-1,3-thiazol-4-yl)octa-1,5,7-trien-3-yl] acetate |
|---|---|
| PubChem CID | 11266290 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [(1E,3S,5Z)-2,6-dimethyl-1-(2-methyl-1,3-thiazol-4-yl)octa-1,5,7-trien-3-yl] acetate |
| SMILES | C=C/C(C)=C\C[C@H](OC(C)=O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C16H21NO2S/c1-6-11(2)7-8-16(19-14(5)18)12(3)9-15-10-20-13(4)17-15/h6-7,9-10,16H,1,8H2,2-5H3/b11-7-,12-9+/t16-/m0/s1 |
| InChIKey | JOXBQLMKHVTSOC-PNEZLPGLSA-N |
| XLogP | 4.31 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|