C27H41NO5S — CID 10814980
[(1E,3R)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] (1S,2S,5R,6S,7S)-2,6-dihydroxy-3,3,5,7-tetramethyl-4-oxocycloundecane-1-carboxylate (PubChem CID 10814980) has the molecular formula C27H41NO5S and a molecular weight of 491.69 g/mol. Its IUPAC name is [(1E,3R)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] (1S,2S,5R,6S,7S)-2,6-dihydroxy-3,3,5,7-tetramethyl-4-oxocycloundecane-1-carboxylate.
| Compound Name | [(1E,3R)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] (1S,2S,5R,6S,7S)-2,6-dihydroxy-3,3,5,7-tetramethyl-4-oxocycloundecane-1-carboxylate |
|---|---|
| PubChem CID | 10814980 |
| Molecular Formula | C27H41NO5S |
| Molecular Weight | 491.69 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | [(1E,3R)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] (1S,2S,5R,6S,7S)-2,6-dihydroxy-3,3,5,7-tetramethyl-4-oxocycloundecane-1-carboxylate |
| SMILES | C=CC[C@@H](OC(=O)[C@H]1CCCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@H]1O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C27H41NO5S/c1-8-11-22(17(3)14-20-15-34-19(5)28-20)33-26(32)21-13-10-9-12-16(2)23(29)18(4)24(30)27(6,7)25(21)31/h8,14-16,18,21-23,25,29,31H,1,9-13H2,2-7H3/b17-14+/t16-,18+,21-,22+,23-,25-/m0/s1 |
| InChIKey | ZDIOIYITKHXMDX-MYJBAWJKSA-N |
| XLogP | 5.12 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|