C28H46N2O5S — CID 163423996
(4S,7R,8S,9S,13S,14S,16S)-4,8-dihydroxy-14-methoxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione (PubChem CID 163423996) has the molecular formula C28H46N2O5S and a molecular weight of 522.75 g/mol. Its IUPAC name is (4S,7R,8S,9S,13S,14S,16S)-4,8-dihydroxy-14-methoxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13S,14S,16S)-4,8-dihydroxy-14-methoxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 163423996 |
| Molecular Formula | C28H46N2O5S |
| Molecular Weight | 522.75 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | (4S,7R,8S,9S,13S,14S,16S)-4,8-dihydroxy-14-methoxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione |
| SMILES | CO[C@H]1C[C@@H](/C(C)=C/c2csc(C)n2)NC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C28H46N2O5S/c1-16-10-9-11-17(2)26(33)19(4)27(34)28(6,7)24(31)14-25(32)30-22(13-23(16)35-8)18(3)12-21-15-36-20(5)29-21/h12,15-17,19,22-24,26,31,33H,9-11,13-14H2,1-8H3,(H,30,32)/b18-12+/t16-,17-,19+,22-,23-,24-,26-/m0/s1 |
| InChIKey | AKXDWPQSRUYGPA-MACDJVABSA-N |
| XLogP | 4.54 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |