C27H44N2O4S — CID 118141707
(4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione (PubChem CID 118141707) has the molecular formula C27H44N2O4S and a molecular weight of 492.73 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 118141707 |
| Molecular Formula | C27H44N2O4S |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1CCC(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C27H44N2O4S/c1-16-9-8-10-17(2)25(32)19(4)26(33)27(6,7)23(30)14-24(31)29-22(12-11-16)18(3)13-21-15-34-20(5)28-21/h13,15-17,19,22-23,25,30,32H,8-12,14H2,1-7H3,(H,29,31)/b18-13+/t16?,17-,19+,22-,23-,25-/m0/s1 |
| InChIKey | KBQJHLVSSJTWPY-HPHJOUOXSA-N |
| XLogP | 4.92 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |