C28H42Cl2N2O4S — CID 59066051
(1S,3S,7S,10R,11S,16R)-17,17-dichloro-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59066051) has the molecular formula C28H42Cl2N2O4S and a molecular weight of 573.63 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,16R)-17,17-dichloro-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,16R)-17,17-dichloro-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59066051 |
| Molecular Formula | C28H42Cl2N2O4S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | (1S,3S,7S,10R,11S,16R)-17,17-dichloro-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1C[C@@H]2C(Cl)(Cl)[C@]2(C)CCCC(C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C28H42Cl2N2O4S/c1-15-9-8-10-27(7)21(28(27,29)30)12-20(16(2)11-19-14-37-18(4)31-19)32-23(34)13-22(33)26(5,6)25(36)17(3)24(15)35/h11,14-15,17,20-22,24,33,35H,8-10,12-13H2,1-7H3,(H,32,34)/b16-11+/t15?,17-,20+,21+,22+,24+,27-/m1/s1 |
| InChIKey | GSFKDHNRXOIISR-DWBYNKMKSA-N |
| XLogP | 5.70 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|