C27H43IN2O5S — CID 66837244
(4S,7R,8S,9S,13R,14S,16S)-4,8,14-trihydroxy-13-iodo-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione (PubChem CID 66837244) has the molecular formula C27H43IN2O5S and a molecular weight of 634.62 g/mol. Its IUPAC name is (4S,7R,8S,9S,13R,14S,16S)-4,8,14-trihydroxy-13-iodo-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13R,14S,16S)-4,8,14-trihydroxy-13-iodo-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 66837244 |
| Molecular Formula | C27H43IN2O5S |
| Molecular Weight | 634.62 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | (4S,7R,8S,9S,13R,14S,16S)-4,8,14-trihydroxy-13-iodo-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-azacyclohexadecane-2,6-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1C[C@H](O)[C@](C)(I)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C27H43IN2O5S/c1-15-9-8-10-27(7,28)22(32)12-20(16(2)11-19-14-36-18(4)29-19)30-23(33)13-21(31)26(5,6)25(35)17(3)24(15)34/h11,14-15,17,20-22,24,31-32,34H,8-10,12-13H2,1-7H3,(H,30,33)/b16-11+/t15-,17+,20-,21-,22-,24-,27+/m0/s1 |
| InChIKey | IDRSUJGKBUKXEU-PVYNADRNSA-N |
| XLogP | 4.45 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|