C26H41N3O5S — CID 146222069
(2R,6S,9R,10S,11S,15R)-15-amino-6,10-dihydroxy-7,7,9,11-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-16-oxa-3-azabicyclo[13.1.1]heptadecane-4,8-dione (PubChem CID 146222069) has the molecular formula C26H41N3O5S and a molecular weight of 507.70 g/mol. Its IUPAC name is (2R,6S,9R,10S,11S,15R)-15-amino-6,10-dihydroxy-7,7,9,11-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-16-oxa-3-azabicyclo[13.1.1]heptadecane-4,8-dione.
| Compound Name | (2R,6S,9R,10S,11S,15R)-15-amino-6,10-dihydroxy-7,7,9,11-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-16-oxa-3-azabicyclo[13.1.1]heptadecane-4,8-dione |
|---|---|
| PubChem CID | 146222069 |
| Molecular Formula | C26H41N3O5S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (2R,6S,9R,10S,11S,15R)-15-amino-6,10-dihydroxy-7,7,9,11-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-16-oxa-3-azabicyclo[13.1.1]heptadecane-4,8-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@H]1NC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC[C@]2(N)CC1O2 |
| InChI | InChI=1S/C26H41N3O5S/c1-14-8-7-9-26(27)12-19(34-26)22(15(2)10-18-13-35-17(4)28-18)29-21(31)11-20(30)25(5,6)24(33)16(3)23(14)32/h10,13-14,16,19-20,22-23,30,32H,7-9,11-12,27H2,1-6H3,(H,29,31)/b15-10+/t14-,16+,19?,20-,22+,23-,26+/m0/s1 |
| InChIKey | AEEXOKYHNHUXKA-SYISXQGBSA-N |
| XLogP | 2.95 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |