C30H46N2O6S — CID 59887818
(8S,13E,16S)-13-(1,3-dioxolan-2-ylmethyl)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 59887818) has the molecular formula C30H46N2O6S and a molecular weight of 562.77 g/mol. Its IUPAC name is (8S,13E,16S)-13-(1,3-dioxolan-2-ylmethyl)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | (8S,13E,16S)-13-(1,3-dioxolan-2-ylmethyl)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 59887818 |
| Molecular Formula | C30H46N2O6S |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | (8S,13E,16S)-13-(1,3-dioxolan-2-ylmethyl)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1C/C=C(/CC2OCCO2)CCCC(C)[C@H](O)C(C)C(=O)C(C)(C)C(O)CC(=O)N1 |
| InChI | InChI=1S/C30H46N2O6S/c1-18-8-7-9-22(15-27-37-12-13-38-27)10-11-24(19(2)14-23-17-39-21(4)31-23)32-26(34)16-25(33)30(5,6)29(36)20(3)28(18)35/h10,14,17-18,20,24-25,27-28,33,35H,7-9,11-13,15-16H2,1-6H3,(H,32,34)/b19-14+,22-10+/t18?,20?,24-,25?,28-/m0/s1 |
| InChIKey | QOALQVVDICFPFM-RJCHZVRZSA-N |
| XLogP | 4.58 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|