C25H37FN2O6S — CID 21456293
(5R,6R,7R,10S,14R)-1-fluoro-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,17-dioxa-13-azabicyclo[14.1.0]heptadecane-8,12-dione (PubChem CID 21456293) has the molecular formula C25H37FN2O6S and a molecular weight of 512.64 g/mol. Its IUPAC name is (5R,6R,7R,10S,14R)-1-fluoro-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,17-dioxa-13-azabicyclo[14.1.0]heptadecane-8,12-dione.
| Compound Name | (5R,6R,7R,10S,14R)-1-fluoro-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,17-dioxa-13-azabicyclo[14.1.0]heptadecane-8,12-dione |
|---|---|
| PubChem CID | 21456293 |
| Molecular Formula | C25H37FN2O6S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | (5R,6R,7R,10S,14R)-1-fluoro-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,17-dioxa-13-azabicyclo[14.1.0]heptadecane-8,12-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@H]1CC2OC2(F)COC[C@@H](C)[C@@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C25H37FN2O6S/c1-13(7-17-11-35-16(4)27-17)18-8-20-25(26,34-20)12-33-10-14(2)22(31)15(3)23(32)24(5,6)19(29)9-21(30)28-18/h7,11,14-15,18-20,22,29,31H,8-10,12H2,1-6H3,(H,28,30)/b13-7+/t14-,15-,18-,19+,20?,22-,25?/m1/s1 |
| InChIKey | MVGUOTBHVKEIQE-DNBADNGVSA-N |
| XLogP | 2.80 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|