C26H37N3O6S — CID 21456342
(5R,6R,7R,10S,14R)-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-8,12-dioxo-3,17-dioxa-13-azabicyclo[14.1.0]heptadecane-1-carbonitrile (PubChem CID 21456342) has the molecular formula C26H37N3O6S and a molecular weight of 519.66 g/mol. Its IUPAC name is (5R,6R,7R,10S,14R)-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-8,12-dioxo-3,17-dioxa-13-azabicyclo[14.1.0]heptadecane-1-carbonitrile.
| Compound Name | (5R,6R,7R,10S,14R)-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-8,12-dioxo-3,17-dioxa-13-azabicyclo[14.1.0]heptadecane-1-carbonitrile |
|---|---|
| PubChem CID | 21456342 |
| Molecular Formula | C26H37N3O6S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | (5R,6R,7R,10S,14R)-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-8,12-dioxo-3,17-dioxa-13-azabicyclo[14.1.0]heptadecane-1-carbonitrile |
| SMILES | C/C(=C\c1csc(C)n1)[C@H]1CC2OC2(C#N)COC[C@@H](C)[C@@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C26H37N3O6S/c1-14(7-18-11-36-17(4)28-18)19-8-21-26(12-27,35-21)13-34-10-15(2)23(32)16(3)24(33)25(5,6)20(30)9-22(31)29-19/h7,11,15-16,19-21,23,30,32H,8-10,13H2,1-6H3,(H,29,31)/b14-7+/t15-,16-,19-,20+,21?,23-,26?/m1/s1 |
| InChIKey | KDXADQPDHWYALJ-HSRTZQEMSA-N |
| XLogP | 2.40 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|