C25H36ClNO7S — CID 91166844
(1S,5S,6S,7R,10S,14S,16S)-1-chloro-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,13,17-trioxabicyclo[14.1.0]heptadecane-8,12-dione (PubChem CID 91166844) has the molecular formula C25H36ClNO7S and a molecular weight of 530.08 g/mol. Its IUPAC name is (1S,5S,6S,7R,10S,14S,16S)-1-chloro-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,13,17-trioxabicyclo[14.1.0]heptadecane-8,12-dione.
| Compound Name | (1S,5S,6S,7R,10S,14S,16S)-1-chloro-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,13,17-trioxabicyclo[14.1.0]heptadecane-8,12-dione |
|---|---|
| PubChem CID | 91166844 |
| Molecular Formula | C25H36ClNO7S |
| Molecular Weight | 530.08 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | (1S,5S,6S,7R,10S,14S,16S)-1-chloro-6,10-dihydroxy-5,7,9,9-tetramethyl-14-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,13,17-trioxabicyclo[14.1.0]heptadecane-8,12-dione |
| SMILES | CC(=Cc1csc(C)n1)[C@@H]1C[C@@H]2O[C@]2(Cl)COC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C25H36ClNO7S/c1-13(7-17-11-35-16(4)27-17)18-8-20-25(26,34-20)12-32-10-14(2)22(30)15(3)23(31)24(5,6)19(28)9-21(29)33-18/h7,11,14-15,18-20,22,28,30H,8-10,12H2,1-6H3/t14-,15+,18-,19-,20-,22-,25+/m0/s1 |
| InChIKey | FOCTUEUYEJKZIU-PHJKYEPVSA-N |
| XLogP | 3.50 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.08 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|