C25H37NO7S — CID 139912617
6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,13,17-trioxabicyclo[14.1.0]heptadecane-8,12-dione (PubChem CID 139912617) has the molecular formula C25H37NO7S and a molecular weight of 495.64 g/mol. Its IUPAC name is 6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,13,17-trioxabicyclo[14.1.0]heptadecane-8,12-dione.
| Compound Name | 6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,13,17-trioxabicyclo[14.1.0]heptadecane-8,12-dione |
|---|---|
| PubChem CID | 139912617 |
| Molecular Formula | C25H37NO7S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 6,10-dihydroxy-5,7,9,9-tetramethyl-14-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-3,13,17-trioxabicyclo[14.1.0]heptadecane-8,12-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1CC2OC2COCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O1 |
| InChI | InChI=1S/C25H37NO7S/c1-13(7-17-12-34-16(4)26-17)18-8-19-20(32-19)11-31-10-14(2)23(29)15(3)24(30)25(5,6)21(27)9-22(28)33-18/h7,12,14-15,18-21,23,27,29H,8-11H2,1-6H3/b13-7+ |
| InChIKey | NEHUCPVIAPTZFS-NTUHNPAUSA-N |
| XLogP | 2.93 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|