C26H39NO6S — CID 58594619
(4S,7R,8S,9S,11E,16S)-4,8,14-trihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-11-ene-2,6-dione (PubChem CID 58594619) has the molecular formula C26H39NO6S and a molecular weight of 493.67 g/mol. Its IUPAC name is (4S,7R,8S,9S,11E,16S)-4,8,14-trihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-11-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,11E,16S)-4,8,14-trihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-11-ene-2,6-dione |
|---|---|
| PubChem CID | 58594619 |
| Molecular Formula | C26H39NO6S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (4S,7R,8S,9S,11E,16S)-4,8,14-trihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-11-ene-2,6-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1CC(O)C/C=C/C[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H39NO6S/c1-15-9-7-8-10-20(28)12-21(16(2)11-19-14-34-18(4)27-19)33-23(30)13-22(29)26(5,6)25(32)17(3)24(15)31/h7-8,11,14-15,17,20-22,24,28-29,31H,9-10,12-13H2,1-6H3/b8-7+,16-11+/t15-,17+,20?,21-,22-,24-/m0/s1 |
| InChIKey | UTVCHKPZBPKNBL-YAHJNECESA-N |
| XLogP | 3.85 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|