C28H38F3NO5S — CID 91188908
(4S,7R,8S,9S,17S)-4,8-dihydroxy-5,5,7,9-tetramethyl-17-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-14-(trifluoromethyl)-1-oxacycloheptadeca-11,14-diene-2,6-dione (PubChem CID 91188908) has the molecular formula C28H38F3NO5S and a molecular weight of 557.68 g/mol. Its IUPAC name is (4S,7R,8S,9S,17S)-4,8-dihydroxy-5,5,7,9-tetramethyl-17-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-14-(trifluoromethyl)-1-oxacycloheptadeca-11,14-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,17S)-4,8-dihydroxy-5,5,7,9-tetramethyl-17-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-14-(trifluoromethyl)-1-oxacycloheptadeca-11,14-diene-2,6-dione |
|---|---|
| PubChem CID | 91188908 |
| Molecular Formula | C28H38F3NO5S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (4S,7R,8S,9S,17S)-4,8-dihydroxy-5,5,7,9-tetramethyl-17-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-14-(trifluoromethyl)-1-oxacycloheptadeca-11,14-diene-2,6-dione |
| SMILES | CC(=Cc1csc(C)n1)[C@@H]1CC=C(C(F)(F)F)CC=CC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C28H38F3NO5S/c1-16-9-7-8-10-20(28(29,30)31)11-12-22(17(2)13-21-15-38-19(4)32-21)37-24(34)14-23(33)27(5,6)26(36)18(3)25(16)35/h7-8,11,13,15-16,18,22-23,25,33,35H,9-10,12,14H2,1-6H3/t16-,18+,22-,23-,25-/m0/s1 |
| InChIKey | FOVGFOGDFGNZAP-JSJWUFMYSA-N |
| XLogP | 5.97 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|