C27H38F3NO5S — CID 91193441
(4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-13-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 91193441) has the molecular formula C27H38F3NO5S and a molecular weight of 545.66 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-13-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-13-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 91193441 |
| Molecular Formula | C27H38F3NO5S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-13-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC(=Cc1csc(C)n1)[C@@H]1CC=C(C(F)(F)F)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H38F3NO5S/c1-15-8-7-9-19(27(28,29)30)10-11-21(16(2)12-20-14-37-18(4)31-20)36-23(33)13-22(32)26(5,6)25(35)17(3)24(15)34/h10,12,14-15,17,21-22,24,32,34H,7-9,11,13H2,1-6H3/t15-,17+,21-,22-,24-/m0/s1 |
| InChIKey | RPAHBNHAJIXTIG-JKPLDMGGSA-N |
| XLogP | 5.81 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|