C27H41NO6S — CID 90746058
(4S,7R,8S,9S,16S)-4,8,12-trihydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 90746058) has the molecular formula C27H41NO6S and a molecular weight of 507.69 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-4,8,12-trihydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-4,8,12-trihydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 90746058 |
| Molecular Formula | C27H41NO6S |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | (4S,7R,8S,9S,16S)-4,8,12-trihydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CC[C@@H](C(C)=Cc2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC1O |
| InChI | InChI=1S/C27H41NO6S/c1-15-9-11-22(17(3)12-20-14-35-19(5)28-20)34-24(31)13-23(30)27(6,7)26(33)18(4)25(32)16(2)8-10-21(15)29/h9,12,14,16,18,21-23,25,29-30,32H,8,10-11,13H2,1-7H3/t16-,18+,21?,22-,23-,25-/m0/s1 |
| InChIKey | OVTIAJMULHNXIE-CDLULSSXSA-N |
| XLogP | 4.24 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|