C28H43NO7S — CID 59097767
(4S,7R,8S,9S,14Z,17S)-4,8,11,12-tetrahydroxy-5,5,7,9,14-pentamethyl-17-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacycloheptadec-14-ene-2,6-dione (PubChem CID 59097767) has the molecular formula C28H43NO7S and a molecular weight of 537.72 g/mol. Its IUPAC name is (4S,7R,8S,9S,14Z,17S)-4,8,11,12-tetrahydroxy-5,5,7,9,14-pentamethyl-17-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacycloheptadec-14-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,14Z,17S)-4,8,11,12-tetrahydroxy-5,5,7,9,14-pentamethyl-17-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacycloheptadec-14-ene-2,6-dione |
|---|---|
| PubChem CID | 59097767 |
| Molecular Formula | C28H43NO7S |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | (4S,7R,8S,9S,14Z,17S)-4,8,11,12-tetrahydroxy-5,5,7,9,14-pentamethyl-17-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacycloheptadec-14-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CC(O)C(O)C1 |
| InChI | InChI=1S/C28H43NO7S/c1-15-8-9-23(16(2)11-20-14-37-19(5)29-20)36-25(33)13-24(32)28(6,7)27(35)18(4)26(34)17(3)12-22(31)21(30)10-15/h8,11,14,17-18,21-24,26,30-32,34H,9-10,12-13H2,1-7H3/b15-8-,16-11+/t17-,18+,21?,22?,23-,24-,26-/m0/s1 |
| InChIKey | BGWKFQIGRNYFMH-KKTJXKEISA-N |
| XLogP | 3.60 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|