C27H41NO7S — CID 90895433
(4S,7R,8S,9S,16S)-4,8,11,12-tetrahydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 90895433) has the molecular formula C27H41NO7S and a molecular weight of 523.69 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-4,8,11,12-tetrahydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-4,8,11,12-tetrahydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 90895433 |
| Molecular Formula | C27H41NO7S |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | (4S,7R,8S,9S,16S)-4,8,11,12-tetrahydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CC[C@@H](C(C)=Cc2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CC(O)C1O |
| InChI | InChI=1S/C27H41NO7S/c1-14-8-9-21(15(2)10-19-13-36-18(5)28-19)35-23(31)12-22(30)27(6,7)26(34)17(4)24(32)16(3)11-20(29)25(14)33/h8,10,13,16-17,20-22,24-25,29-30,32-33H,9,11-12H2,1-7H3/t16-,17+,20?,21-,22-,24-,25?/m0/s1 |
| InChIKey | YVERUKZXFCBCPG-UAFZQZQPSA-N |
| XLogP | 3.21 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|