C27H39NO5S — CID 10368278
(2E,9S,12R,13R,14R)-9,13-dihydroxy-10,10,12,14-tetramethyl-5-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6-oxabicyclo[14.1.0]heptadec-2-ene-7,11-dione (PubChem CID 10368278) has the molecular formula C27H39NO5S and a molecular weight of 489.68 g/mol. Its IUPAC name is (2E,9S,12R,13R,14R)-9,13-dihydroxy-10,10,12,14-tetramethyl-5-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6-oxabicyclo[14.1.0]heptadec-2-ene-7,11-dione.
| Compound Name | (2E,9S,12R,13R,14R)-9,13-dihydroxy-10,10,12,14-tetramethyl-5-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6-oxabicyclo[14.1.0]heptadec-2-ene-7,11-dione |
|---|---|
| PubChem CID | 10368278 |
| Molecular Formula | C27H39NO5S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (2E,9S,12R,13R,14R)-9,13-dihydroxy-10,10,12,14-tetramethyl-5-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6-oxabicyclo[14.1.0]heptadec-2-ene-7,11-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1C/C=C/C2CC2C[C@@H](C)[C@@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H39NO5S/c1-15(11-21-14-34-18(4)28-21)22-9-7-8-19-12-20(19)10-16(2)25(31)17(3)26(32)27(5,6)23(29)13-24(30)33-22/h7-8,11,14,16-17,19-20,22-23,25,29,31H,9-10,12-13H2,1-6H3/b8-7+,15-11+/t16-,17-,19?,20?,22?,23+,25-/m1/s1 |
| InChIKey | SJODRNZQSLZTQX-WFMVNMEESA-N |
| XLogP | 4.73 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|