C30H46N2O6S — CID 90759154
(6S,10S,13R,14S,15S)-10,14-dihydroxy-3,11,11,13,15,19-hexamethyl-6-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7,18-dioxa-19-azabicyclo[15.3.0]icos-3-ene-8,12-dione (PubChem CID 90759154) has the molecular formula C30H46N2O6S and a molecular weight of 562.77 g/mol. Its IUPAC name is (6S,10S,13R,14S,15S)-10,14-dihydroxy-3,11,11,13,15,19-hexamethyl-6-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7,18-dioxa-19-azabicyclo[15.3.0]icos-3-ene-8,12-dione.
| Compound Name | (6S,10S,13R,14S,15S)-10,14-dihydroxy-3,11,11,13,15,19-hexamethyl-6-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7,18-dioxa-19-azabicyclo[15.3.0]icos-3-ene-8,12-dione |
|---|---|
| PubChem CID | 90759154 |
| Molecular Formula | C30H46N2O6S |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | (6S,10S,13R,14S,15S)-10,14-dihydroxy-3,11,11,13,15,19-hexamethyl-6-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7,18-dioxa-19-azabicyclo[15.3.0]icos-3-ene-8,12-dione |
| SMILES | CC1=CC[C@@H](C(C)=Cc2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CC2ON(C)CC2C1 |
| InChI | InChI=1S/C30H46N2O6S/c1-17-9-10-24(18(2)12-23-16-39-21(5)31-23)37-27(34)14-26(33)30(6,7)29(36)20(4)28(35)19(3)13-25-22(11-17)15-32(8)38-25/h9,12,16,19-20,22,24-26,28,33,35H,10-11,13-15H2,1-8H3/t19-,20+,22?,24-,25?,26-,28-/m0/s1 |
| InChIKey | DTOGNXCGAUVHIG-HWRZSLMUSA-N |
| XLogP | 4.74 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|