C26H40N2O5S — CID 68539424
(4Z,9S,10S,11R,14S)-10,14-dihydroxy-5,9,11,13,13-pentamethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-8-azacyclohexadec-4-ene-12,16-dione (PubChem CID 68539424) has the molecular formula C26H40N2O5S and a molecular weight of 492.68 g/mol. Its IUPAC name is (4Z,9S,10S,11R,14S)-10,14-dihydroxy-5,9,11,13,13-pentamethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-8-azacyclohexadec-4-ene-12,16-dione.
| Compound Name | (4Z,9S,10S,11R,14S)-10,14-dihydroxy-5,9,11,13,13-pentamethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-8-azacyclohexadec-4-ene-12,16-dione |
|---|---|
| PubChem CID | 68539424 |
| Molecular Formula | C26H40N2O5S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (4Z,9S,10S,11R,14S)-10,14-dihydroxy-5,9,11,13,13-pentamethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-8-azacyclohexadec-4-ene-12,16-dione |
| SMILES | C/C1=C/CC(/C(C)=C/c2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@H](O)[C@H](C)NCC1 |
| InChI | InChI=1S/C26H40N2O5S/c1-15-8-9-21(16(2)12-20-14-34-19(5)28-20)33-23(30)13-22(29)26(6,7)25(32)17(3)24(31)18(4)27-11-10-15/h8,12,14,17-18,21-22,24,27,29,31H,9-11,13H2,1-7H3/b15-8-,16-12+/t17-,18+,21?,22+,24+/m1/s1 |
| InChIKey | LPQOWKIXUVVLHI-OMAYBZIXSA-N |
| XLogP | 3.83 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|