C27H38FNO5S — CID 90786849
(4S,7R,8S,9S,16S)-13-(fluoromethyl)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 90786849) has the molecular formula C27H38FNO5S and a molecular weight of 507.67 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-13-(fluoromethyl)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-13-(fluoromethyl)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 90786849 |
| Molecular Formula | C27H38FNO5S |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (4S,7R,8S,9S,16S)-13-(fluoromethyl)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC(=Cc1csc(C)n1)[C@@H]1CC=C(CF)C=CC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H38FNO5S/c1-16-8-7-9-20(14-28)10-11-22(17(2)12-21-15-35-19(4)29-21)34-24(31)13-23(30)27(5,6)26(33)18(3)25(16)32/h7,9-10,12,15-16,18,22-23,25,30,32H,8,11,13-14H2,1-6H3/t16-,18+,22-,23-,25-/m0/s1 |
| InChIKey | ZLEIKJNTIUJLGU-JSJWUFMYSA-N |
| XLogP | 4.99 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |