C28H42N2O6S — CID 23521743
17-acetyl-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 23521743) has the molecular formula C28H42N2O6S and a molecular weight of 534.72 g/mol. Its IUPAC name is 17-acetyl-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 17-acetyl-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 23521743 |
| Molecular Formula | C28H42N2O6S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 17-acetyl-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=O)N1C2CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)OC(/C(C)=C/c3csc(C)n3)CC21 |
| InChI | InChI=1S/C28H42N2O6S/c1-15-9-8-10-21-22(30(21)19(5)31)12-23(16(2)11-20-14-37-18(4)29-20)36-25(33)13-24(32)28(6,7)27(35)17(3)26(15)34/h11,14-15,17,21-24,26,32,34H,8-10,12-13H2,1-7H3/b16-11+ |
| InChIKey | ORAGYCSXIZIJKI-LFIBNONCSA-N |
| XLogP | 3.92 |
| TPSA | 116.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|