C29H44N2O7S — CID 59066073
ethyl (7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-4-oxa-17-azabicyclo[14.1.0]heptadecane-17-carboxylate (PubChem CID 59066073) has the molecular formula C29H44N2O7S and a molecular weight of 564.75 g/mol. Its IUPAC name is ethyl (7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-4-oxa-17-azabicyclo[14.1.0]heptadecane-17-carboxylate.
| Compound Name | ethyl (7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-4-oxa-17-azabicyclo[14.1.0]heptadecane-17-carboxylate |
|---|---|
| PubChem CID | 59066073 |
| Molecular Formula | C29H44N2O7S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | ethyl (7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-4-oxa-17-azabicyclo[14.1.0]heptadecane-17-carboxylate |
| SMILES | CCOC(=O)N1C2CC(/C(C)=C/c3csc(C)n3)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC[C@H]21 |
| InChI | InChI=1S/C29H44N2O7S/c1-8-37-28(36)31-21-11-9-10-16(2)26(34)18(4)27(35)29(6,7)24(32)14-25(33)38-23(13-22(21)31)17(3)12-20-15-39-19(5)30-20/h12,15-16,18,21-24,26,32,34H,8-11,13-14H2,1-7H3/b17-12+/t16-,18+,21+,22?,23?,24-,26-,31?/m0/s1 |
| InChIKey | JRKBDIZRCRGAIO-HLQOMDMHSA-N |
| XLogP | 4.53 |
| TPSA | 126.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|