C28H44N2O6S — CID 59628537
(11S,16R)-7,11-dihydroxy-17-(2-hydroxyethyl)-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59628537) has the molecular formula C28H44N2O6S and a molecular weight of 536.74 g/mol. Its IUPAC name is (11S,16R)-7,11-dihydroxy-17-(2-hydroxyethyl)-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (11S,16R)-7,11-dihydroxy-17-(2-hydroxyethyl)-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59628537 |
| Molecular Formula | C28H44N2O6S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (11S,16R)-7,11-dihydroxy-17-(2-hydroxyethyl)-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1CC2[C@@H](CCCC(C)[C@H](O)C(C)C(=O)C(C)(C)C(O)CC(=O)O1)N2CCO |
| InChI | InChI=1S/C28H44N2O6S/c1-16-8-7-9-21-22(30(21)10-11-31)13-23(17(2)12-20-15-37-19(4)29-20)36-25(33)14-24(32)28(5,6)27(35)18(3)26(16)34/h12,15-16,18,21-24,26,31-32,34H,7-11,13-14H2,1-6H3/b17-12+/t16?,18?,21-,22?,23?,24?,26+,30?/m1/s1 |
| InChIKey | NYZHXWITYIYXQL-OCLOAIFYSA-N |
| XLogP | 3.37 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|