C28H43NO6S — CID 10311583
(1S,2S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-2,8,8,10,12,16-hexamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 10311583) has the molecular formula C28H43NO6S and a molecular weight of 521.72 g/mol. Its IUPAC name is (1S,2S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-2,8,8,10,12,16-hexamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,2S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-2,8,8,10,12,16-hexamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 10311583 |
| Molecular Formula | C28H43NO6S |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | (1S,2S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-2,8,8,10,12,16-hexamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@H]1OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC[C@@]2(C)O[C@H]2[C@H]1C |
| InChI | InChI=1S/C28H43NO6S/c1-15-10-9-11-28(8)26(35-28)18(4)24(16(2)12-20-14-36-19(5)29-20)34-22(31)13-21(30)27(6,7)25(33)17(3)23(15)32/h12,14-15,17-18,21,23-24,26,30,32H,9-11,13H2,1-8H3/b16-12+/t15-,17+,18-,21-,23-,24+,26-,28+/m0/s1 |
| InChIKey | KBSHPFNBYZYYTE-JJRGMHNCSA-N |
| XLogP | 4.72 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|