C26H40INO6S — CID 123443603
(4S,7R,8S,13R,14R)-4,8,13-trihydroxy-14-iodo-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione (PubChem CID 123443603) has the molecular formula C26H40INO6S and a molecular weight of 621.58 g/mol. Its IUPAC name is (4S,7R,8S,13R,14R)-4,8,13-trihydroxy-14-iodo-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione.
| Compound Name | (4S,7R,8S,13R,14R)-4,8,13-trihydroxy-14-iodo-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 123443603 |
| Molecular Formula | C26H40INO6S |
| Molecular Weight | 621.58 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | (4S,7R,8S,13R,14R)-4,8,13-trihydroxy-14-iodo-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-oxacyclohexadecane-2,6-dione |
| SMILES | CC(=Cc1csc(C)n1)C1C[C@@H](I)[C@H](O)CCCC(C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H40INO6S/c1-14-8-7-9-20(29)19(27)11-21(15(2)10-18-13-35-17(4)28-18)34-23(31)12-22(30)26(5,6)25(33)16(3)24(14)32/h10,13-14,16,19-22,24,29-30,32H,7-9,11-12H2,1-6H3/t14?,16-,19-,20-,21?,22+,24+/m1/s1 |
| InChIKey | IFXQCDPGBAKRLI-OZIUKVSHSA-N |
| XLogP | 4.48 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|