C26H40N2O5S — CID 59066043
(1S,3S,7S,10R,11S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59066043) has the molecular formula C26H40N2O5S and a molecular weight of 492.68 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59066043 |
| Molecular Formula | C26H40N2O5S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (1S,3S,7S,10R,11S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1C[C@@H]2NC2CCCC(C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H40N2O5S/c1-14-8-7-9-19-20(28-19)11-21(15(2)10-18-13-34-17(4)27-18)33-23(30)12-22(29)26(5,6)25(32)16(3)24(14)31/h10,13-14,16,19-22,24,28-29,31H,7-9,11-12H2,1-6H3/b15-10+/t14?,16-,19?,20+,21+,22+,24+/m1/s1 |
| InChIKey | NDJGRLMPHYANAD-GYLZBIJKSA-N |
| XLogP | 3.66 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|