C27H42N2O5S — CID 74956294
4,8-dihydroxy-15-[1-hydroxy-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enyl]-5,5,7,9,13-pentamethyl-1-azacyclopentadec-13-ene-2,6-dione (PubChem CID 74956294) has the molecular formula C27H42N2O5S and a molecular weight of 506.71 g/mol. Its IUPAC name is 4,8-dihydroxy-15-[1-hydroxy-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enyl]-5,5,7,9,13-pentamethyl-1-azacyclopentadec-13-ene-2,6-dione.
| Compound Name | 4,8-dihydroxy-15-[1-hydroxy-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enyl]-5,5,7,9,13-pentamethyl-1-azacyclopentadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 74956294 |
| Molecular Formula | C27H42N2O5S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 4,8-dihydroxy-15-[1-hydroxy-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enyl]-5,5,7,9,13-pentamethyl-1-azacyclopentadec-13-ene-2,6-dione |
| SMILES | CC1=CC(C(O)C(C)=Cc2csc(C)n2)NC(=O)CC(O)C(C)(C)C(=O)C(C)C(O)C(C)CCC1 |
| InChI | InChI=1S/C27H42N2O5S/c1-15-9-8-10-16(2)24(32)18(4)26(34)27(6,7)22(30)13-23(31)29-21(11-15)25(33)17(3)12-20-14-35-19(5)28-20/h11-12,14,16,18,21-22,24-25,30,32-33H,8-10,13H2,1-7H3,(H,29,31) |
| InChIKey | VPEZYDDJKBNYGP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|