C28H43NO5S — CID 73207838
4,8-dihydroxy-5,5,7,9,13,16-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 73207838) has the molecular formula C28H43NO5S and a molecular weight of 505.72 g/mol. Its IUPAC name is 4,8-dihydroxy-5,5,7,9,13,16-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | 4,8-dihydroxy-5,5,7,9,13,16-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 73207838 |
| Molecular Formula | C28H43NO5S |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 4,8-dihydroxy-5,5,7,9,13,16-hexamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CCC(C)(C(C)=Cc2csc(C)n2)OC(=O)CC(O)C(C)(C)C(=O)C(C)C(O)C(C)CCC1 |
| InChI | InChI=1S/C28H43NO5S/c1-17-10-9-11-18(2)25(32)20(4)26(33)27(6,7)23(30)15-24(31)34-28(8,13-12-17)19(3)14-22-16-35-21(5)29-22/h12,14,16,18,20,23,25,30,32H,9-11,13,15H2,1-8H3 |
| InChIKey | ORQFZZFZGBDBEN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|