C22H35Cl3O7 — CID 59922941
tert-butyl (3S,7R,8S)-3-methoxy-4,4,8-trimethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate (PubChem CID 59922941) has the molecular formula C22H35Cl3O7 and a molecular weight of 517.87 g/mol. Its IUPAC name is tert-butyl (3S,7R,8S)-3-methoxy-4,4,8-trimethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate.
| Compound Name | tert-butyl (3S,7R,8S)-3-methoxy-4,4,8-trimethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate |
|---|---|
| PubChem CID | 59922941 |
| Molecular Formula | C22H35Cl3O7 |
| Molecular Weight | 517.87 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | tert-butyl (3S,7R,8S)-3-methoxy-4,4,8-trimethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate |
| SMILES | C=CC[C@H](C)[C@@H](CC(=O)C(C)(C)[C@H](CC(=O)OC(C)(C)C)OC)OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H35Cl3O7/c1-9-10-14(2)15(31-19(28)30-13-22(23,24)25)11-16(26)21(6,7)17(29-8)12-18(27)32-20(3,4)5/h9,14-15,17H,1,10-13H2,2-8H3/t14-,15+,17-/m0/s1 |
| InChIKey | QZAHRHRIFSGHTK-UXLLHSPISA-N |
| XLogP | 5.82 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.87 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|