C11H19ClO3 — CID 86054073
tert-butyl 4-chloro-3-hydroxy-4-methylhex-5-enoate (PubChem CID 86054073) has the molecular formula C11H19ClO3 and a molecular weight of 234.72 g/mol. Its IUPAC name is tert-butyl 4-chloro-3-hydroxy-4-methylhex-5-enoate.
| Compound Name | tert-butyl 4-chloro-3-hydroxy-4-methylhex-5-enoate |
|---|---|
| PubChem CID | 86054073 |
| Molecular Formula | C11H19ClO3 |
| Molecular Weight | 234.72 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | tert-butyl 4-chloro-3-hydroxy-4-methylhex-5-enoate |
| SMILES | C=CC(C)(Cl)C(O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19ClO3/c1-6-11(5,12)8(13)7-9(14)15-10(2,3)4/h6,8,13H,1,7H2,2-5H3 |
| InChIKey | MJXKRSUEVNASOC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.72 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|