C18H32O4 — CID 102459601
tert-butyl (3S,5E,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyldeca-5,9-dienoate (PubChem CID 102459601) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is tert-butyl (3S,5E,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyldeca-5,9-dienoate.
| Compound Name | tert-butyl (3S,5E,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyldeca-5,9-dienoate |
|---|---|
| PubChem CID | 102459601 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | tert-butyl (3S,5E,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyldeca-5,9-dienoate |
| SMILES | C=C[C@H](C)[C@H](O)/C(C)=C/C(C)(C)[C@@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32O4/c1-9-12(2)16(21)13(3)11-18(7,8)14(19)10-15(20)22-17(4,5)6/h9,11-12,14,16,19,21H,1,10H2,2-8H3/b13-11+/t12-,14-,16-/m0/s1 |
| InChIKey | SQNCVOLDOOOVCJ-LOGWNLOPSA-N |
| XLogP | 3.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|