C14H29NO3 — CID 110012218
tert-butyl 3-[(2-hydroxy-3,3-dimethylbutyl)amino]butanoate (PubChem CID 110012218) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is tert-butyl 3-[(2-hydroxy-3,3-dimethylbutyl)amino]butanoate.
| Compound Name | tert-butyl 3-[(2-hydroxy-3,3-dimethylbutyl)amino]butanoate |
|---|---|
| PubChem CID | 110012218 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | tert-butyl 3-[(2-hydroxy-3,3-dimethylbutyl)amino]butanoate |
| SMILES | CC(CC(=O)OC(C)(C)C)NCC(O)C(C)(C)C |
| InChI | InChI=1S/C14H29NO3/c1-10(8-12(17)18-14(5,6)7)15-9-11(16)13(2,3)4/h10-11,15-16H,8-9H2,1-7H3 |
| InChIKey | GUPBMNQMWUBFAQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |