C16H24ClNO3 — CID 110013393
tert-butyl 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]butanoate (PubChem CID 110013393) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is tert-butyl 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]butanoate.
| Compound Name | tert-butyl 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]butanoate |
|---|---|
| PubChem CID | 110013393 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | tert-butyl 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]butanoate |
| SMILES | CC(CC(=O)OC(C)(C)C)NCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C16H24ClNO3/c1-11(9-15(20)21-16(2,3)4)18-10-14(19)12-7-5-6-8-13(12)17/h5-8,11,14,18-19H,9-10H2,1-4H3 |
| InChIKey | AIMISQXAQXPMIL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |