C14H20ClNO2 — CID 81378736
tert-butyl 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]acetate (PubChem CID 81378736) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is tert-butyl 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]acetate |
|---|---|
| PubChem CID | 81378736 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]acetate |
| SMILES | C[C@@H](NCC(=O)OC(C)(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C14H20ClNO2/c1-10(11-7-5-6-8-12(11)15)16-9-13(17)18-14(2,3)4/h5-8,10,16H,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | VDQCHVOOXDWBJZ-SNVBAGLBSA-N |
| XLogP | 3.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |