C20H34O5 — CID 59076133
tert-butyl (3S,7R,8S)-3,7-dimethoxy-4,4,8-trimethyl-5-oxoundec-10-ynoate (PubChem CID 59076133) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl (3S,7R,8S)-3,7-dimethoxy-4,4,8-trimethyl-5-oxoundec-10-ynoate.
| Compound Name | tert-butyl (3S,7R,8S)-3,7-dimethoxy-4,4,8-trimethyl-5-oxoundec-10-ynoate |
|---|---|
| PubChem CID | 59076133 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | tert-butyl (3S,7R,8S)-3,7-dimethoxy-4,4,8-trimethyl-5-oxoundec-10-ynoate |
| SMILES | C#CC[C@H](C)[C@@H](CC(=O)C(C)(C)[C@H](CC(=O)OC(C)(C)C)OC)OC |
| InChI | InChI=1S/C20H34O5/c1-10-11-14(2)15(23-8)12-16(21)20(6,7)17(24-9)13-18(22)25-19(3,4)5/h1,14-15,17H,11-13H2,2-9H3/t14-,15+,17-/m0/s1 |
| InChIKey | PZWUKBNZMUULPW-UXLLHSPISA-N |
| XLogP | 3.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|