C17H32Cl3NO5Si — CID 11113362
2,2,2-trichloroethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 11113362) has the molecular formula C17H32Cl3NO5Si and a molecular weight of 464.89 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 2,2,2-trichloroethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 11113362 |
| Molecular Formula | C17H32Cl3NO5Si |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2,2,2-trichloroethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CC(=O)OCC(Cl)(Cl)Cl)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32Cl3NO5Si/c1-15(2,3)25-14(23)21-10-12(26-27(7,8)16(4,5)6)9-13(22)24-11-17(18,19)20/h12H,9-11H2,1-8H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | XMJACHREGZUCCT-GFCCVEGCSA-N |
| XLogP | 5.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|